C24H27Cl2F3N2O5S — CID 169426164
[4-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylcyclohexyl] (2S)-2-amino-3-methylbutanoate;hydrochloride (PubChem CID 169426164) has the molecular formula C24H27Cl2F3N2O5S and a molecular weight of 583.46 g/mol. Its IUPAC name is [4-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylcyclohexyl] (2S)-2-amino-3-methylbutanoate;hydrochloride.
| Compound Name | [4-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylcyclohexyl] (2S)-2-amino-3-methylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 169426164 |
| Molecular Formula | C24H27Cl2F3N2O5S |
| Molecular Weight | 583.46 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | [4-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylcyclohexyl] (2S)-2-amino-3-methylbutanoate;hydrochloride |
| SMILES | CC(C)[C@H](N)C(=O)OC1CCC(S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)CC1.Cl |
| InChI | InChI=1S/C24H26ClF3N2O5S.ClH/c1-12(2)22(29)24(32)35-15-4-6-16(7-5-15)36(33,34)20-9-13(3-8-17(20)25)23(31)30-14-10-18(26)21(28)19(27)11-14;/h3,8-12,15-16,22H,4-7,29H2,1-2H3,(H,30,31);1H/t15?,16?,22-;/m0./s1 |
| InChIKey | CGPCQVKCDWXFOS-IJEHVRFISA-N |
| XLogP | 5.04 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|