C25H26ClF3N2O5S — CID 130425142
tert-butyl 3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 130425142) has the molecular formula C25H26ClF3N2O5S and a molecular weight of 559.01 g/mol. Its IUPAC name is tert-butyl 3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 130425142 |
| Molecular Formula | C25H26ClF3N2O5S |
| Molecular Weight | 559.01 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | tert-butyl 3-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(S(=O)(=O)c1cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc1Cl)C2 |
| InChI | InChI=1S/C25H26ClF3N2O5S/c1-25(2,3)36-24(33)31-15-5-6-16(31)12-17(11-15)37(34,35)21-8-13(4-7-18(21)26)23(32)30-14-9-19(27)22(29)20(28)10-14/h4,7-10,15-17H,5-6,11-12H2,1-3H3,(H,30,32) |
| InChIKey | RNUABNYCCPZXTM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.01 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|