C22H17ClF3NO5S — CID 174028965
(2Z)-2-[7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanylidene]acetic acid (PubChem CID 174028965) has the molecular formula C22H17ClF3NO5S and a molecular weight of 499.89 g/mol. Its IUPAC name is (2Z)-2-[7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanylidene]acetic acid.
| Compound Name | (2Z)-2-[7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanylidene]acetic acid |
|---|---|
| PubChem CID | 174028965 |
| Molecular Formula | C22H17ClF3NO5S |
| Molecular Weight | 499.89 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | (2Z)-2-[7-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-bicyclo[2.2.1]heptanylidene]acetic acid |
| SMILES | O=C(O)/C=C1/CC2CCC1C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C22H17ClF3NO5S/c23-15-4-2-11(22(30)27-13-8-16(24)20(26)17(25)9-13)6-18(15)33(31,32)21-10-1-3-14(21)12(5-10)7-19(28)29/h2,4,6-10,14,21H,1,3,5H2,(H,27,30)(H,28,29)/b12-7- |
| InChIKey | WFZLGBFJWNJKSC-GHXNOFRVSA-N |
| XLogP | 4.59 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|