C22H19ClF3NO6S2 — CID 130397457
4-chloro-3-[(5'S)-2-oxospiro[1,3,2-dioxathiolane-4,3'-bicyclo[3.2.1]octane]-8'-yl]sulfonyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130397457) has the molecular formula C22H19ClF3NO6S2 and a molecular weight of 549.98 g/mol. Its IUPAC name is 4-chloro-3-[(5'S)-2-oxospiro[1,3,2-dioxathiolane-4,3'-bicyclo[3.2.1]octane]-8'-yl]sulfonyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[(5'S)-2-oxospiro[1,3,2-dioxathiolane-4,3'-bicyclo[3.2.1]octane]-8'-yl]sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130397457 |
| Molecular Formula | C22H19ClF3NO6S2 |
| Molecular Weight | 549.98 g/mol |
| Exact Mass | 549.03 |
| IUPAC Name | 4-chloro-3-[(5'S)-2-oxospiro[1,3,2-dioxathiolane-4,3'-bicyclo[3.2.1]octane]-8'-yl]sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CC[C@H]2CC2(COS(=O)O2)C3)c1 |
| InChI | InChI=1S/C22H19ClF3NO6S2/c23-15-4-3-11(21(28)27-14-6-16(24)19(26)17(25)7-14)5-18(15)35(30,31)20-12-1-2-13(20)9-22(8-12)10-32-34(29)33-22/h3-7,12-13,20H,1-2,8-10H2,(H,27,28)/t12-,13?,20?,22?,34?/m0/s1 |
| InChIKey | KYTIBPAVZXSTSS-NPPZVUAGSA-N |
| XLogP | 4.34 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.98 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|