C28H25ClF3NO5S — CID 130402370
4-chloro-3-[[(5R)-3-hydroxy-3-[hydroxy(phenyl)methyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402370) has the molecular formula C28H25ClF3NO5S and a molecular weight of 580.02 g/mol. Its IUPAC name is 4-chloro-3-[[(5R)-3-hydroxy-3-[hydroxy(phenyl)methyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5R)-3-hydroxy-3-[hydroxy(phenyl)methyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402370 |
| Molecular Formula | C28H25ClF3NO5S |
| Molecular Weight | 580.02 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | 4-chloro-3-[[(5R)-3-hydroxy-3-[hydroxy(phenyl)methyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CC[C@@H]2CC(O)(C(O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C28H25ClF3NO5S/c29-20-9-8-16(27(35)33-19-11-21(30)24(32)22(31)12-19)10-23(20)39(37,38)25-17-6-7-18(25)14-28(36,13-17)26(34)15-4-2-1-3-5-15/h1-5,8-12,17-18,25-26,34,36H,6-7,13-14H2,(H,33,35)/t17-,18?,25?,26?,28?/m1/s1 |
| InChIKey | WHBZRDHSOUKUJI-YCWLSPJJSA-N |
| XLogP | 5.44 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.02 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|