C22H21ClF3NO5S — CID 130424976
4-chloro-3-[[6-hydroxy-6-(hydroxymethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130424976) has the molecular formula C22H21ClF3NO5S and a molecular weight of 503.93 g/mol. Its IUPAC name is 4-chloro-3-[[6-hydroxy-6-(hydroxymethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[6-hydroxy-6-(hydroxymethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130424976 |
| Molecular Formula | C22H21ClF3NO5S |
| Molecular Weight | 503.93 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | 4-chloro-3-[[6-hydroxy-6-(hydroxymethyl)-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CCCC2C(O)(CO)C3)c1 |
| InChI | InChI=1S/C22H21ClF3NO5S/c23-15-5-4-11(21(29)27-13-7-16(24)19(26)17(25)8-13)6-18(15)33(31,32)20-12-2-1-3-14(20)22(30,9-12)10-28/h4-8,12,14,20,28,30H,1-3,9-10H2,(H,27,29) |
| InChIKey | ZERNVIOLTZGZSS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.93 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|