C23H23ClF3NO6S — CID 166672040
4-chloro-3-[[(1S,3R,6S)-2,3-dihydroxy-3-(hydroxymethyl)-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 166672040) has the molecular formula C23H23ClF3NO6S and a molecular weight of 533.95 g/mol. Its IUPAC name is 4-chloro-3-[[(1S,3R,6S)-2,3-dihydroxy-3-(hydroxymethyl)-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(1S,3R,6S)-2,3-dihydroxy-3-(hydroxymethyl)-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 166672040 |
| Molecular Formula | C23H23ClF3NO6S |
| Molecular Weight | 533.95 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 4-chloro-3-[[(1S,3R,6S)-2,3-dihydroxy-3-(hydroxymethyl)-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H]1C[C@H]2C(O)[C@](O)(CO)CC1C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C23H23ClF3NO6S/c1-10-4-13-20(14(10)8-23(32,9-29)21(13)30)35(33,34)18-5-11(2-3-15(18)24)22(31)28-12-6-16(25)19(27)17(26)7-12/h2-3,5-7,10,13-14,20-21,29-30,32H,4,8-9H2,1H3,(H,28,31)/t10-,13+,14?,20?,21?,23+/m0/s1 |
| InChIKey | COVHVPDYFZLJHX-GFIHLVKLSA-N |
| XLogP | 2.91 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|