C23H23F3N4O5S — CID 137409594
4-azido-3-[[(3R,6S)-3-hydroxy-3-(hydroxymethyl)-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 137409594) has the molecular formula C23H23F3N4O5S and a molecular weight of 524.52 g/mol. Its IUPAC name is 4-azido-3-[[(3R,6S)-3-hydroxy-3-(hydroxymethyl)-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-azido-3-[[(3R,6S)-3-hydroxy-3-(hydroxymethyl)-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 137409594 |
| Molecular Formula | C23H23F3N4O5S |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 4-azido-3-[[(3R,6S)-3-hydroxy-3-(hydroxymethyl)-6-methyl-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C[C@H]1CC2C[C@](O)(CO)CC1C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1N=[N+]=[N-] |
| InChI | InChI=1S/C23H23F3N4O5S/c1-11-4-13-8-23(33,10-31)9-15(11)21(13)36(34,35)19-5-12(2-3-18(19)29-30-27)22(32)28-14-6-16(24)20(26)17(25)7-14/h2-3,5-7,11,13,15,21,31,33H,4,8-10H2,1H3,(H,28,32)/t11-,13?,15?,21?,23+/m0/s1 |
| InChIKey | OAIUBKVJFMLUTP-UAWRSQPPSA-N |
| XLogP | 4.23 |
| TPSA | 152.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|