C24H21ClF3NO5S — CID 138479749
4-chloro-3-(5'-oxospiro[bicyclo[3.2.1]octane-3,2'-oxolane]-8-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 138479749) has the molecular formula C24H21ClF3NO5S and a molecular weight of 527.95 g/mol. Its IUPAC name is 4-chloro-3-(5'-oxospiro[bicyclo[3.2.1]octane-3,2'-oxolane]-8-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(5'-oxospiro[bicyclo[3.2.1]octane-3,2'-oxolane]-8-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 138479749 |
| Molecular Formula | C24H21ClF3NO5S |
| Molecular Weight | 527.95 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 4-chloro-3-(5'-oxospiro[bicyclo[3.2.1]octane-3,2'-oxolane]-8-yl)sulfonyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C1CCC2(CC3CCC(C2)C3S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)O1 |
| InChI | InChI=1S/C24H21ClF3NO5S/c25-16-4-3-12(23(31)29-15-8-17(26)21(28)18(27)9-15)7-19(16)35(32,33)22-13-1-2-14(22)11-24(10-13)6-5-20(30)34-24/h3-4,7-9,13-14,22H,1-2,5-6,10-11H2,(H,29,31) |
| InChIKey | KZMKHFQEKKCREJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.95 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|