C23H20ClF3N2O5S — CID 166671881
[(1S,8R)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]oct-2-enyl]methyl carbamate (PubChem CID 166671881) has the molecular formula C23H20ClF3N2O5S and a molecular weight of 528.94 g/mol. Its IUPAC name is [(1S,8R)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]oct-2-enyl]methyl carbamate.
| Compound Name | [(1S,8R)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]oct-2-enyl]methyl carbamate |
|---|---|
| PubChem CID | 166671881 |
| Molecular Formula | C23H20ClF3N2O5S |
| Molecular Weight | 528.94 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | [(1S,8R)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-bicyclo[3.2.1]oct-2-enyl]methyl carbamate |
| SMILES | NC(=O)OCC1=C[C@@H]2CCC(C1)[C@H]2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C23H20ClF3N2O5S/c24-16-4-3-14(22(30)29-15-8-17(25)20(27)18(26)9-15)7-19(16)35(32,33)21-12-1-2-13(21)6-11(5-12)10-34-23(28)31/h3-5,7-9,12-13,21H,1-2,6,10H2,(H2,28,31)(H,29,30)/t12-,13?,21-/m0/s1 |
| InChIKey | SIIYCLKNTTZSIB-WRSGWIBUSA-N |
| XLogP | 4.60 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.94 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|