C32H30ClF3N2O4S — CID 130402386
3-[[(1S)-3-(2-benzyl-4-methyl-1,2-oxazolidin-3-yl)-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402386) has the molecular formula C32H30ClF3N2O4S and a molecular weight of 631.12 g/mol. Its IUPAC name is 3-[[(1S)-3-(2-benzyl-4-methyl-1,2-oxazolidin-3-yl)-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[[(1S)-3-(2-benzyl-4-methyl-1,2-oxazolidin-3-yl)-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402386 |
| Molecular Formula | C32H30ClF3N2O4S |
| Molecular Weight | 631.12 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | 3-[[(1S)-3-(2-benzyl-4-methyl-1,2-oxazolidin-3-yl)-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC1CON(Cc2ccccc2)C1C1=C[C@@H]2CCC(C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C32H30ClF3N2O4S/c1-18-17-42-38(16-19-5-3-2-4-6-19)30(18)23-11-20-7-8-21(12-23)31(20)43(40,41)28-13-22(9-10-25(28)33)32(39)37-24-14-26(34)29(36)27(35)15-24/h2-6,9-11,13-15,18,20-21,30-31H,7-8,12,16-17H2,1H3,(H,37,39)/t18?,20-,21?,30?,31?/m0/s1 |
| InChIKey | KERBZEPKTYDLRK-KSWUIRRWSA-N |
| XLogP | 6.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.12 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|