C34H36ClF3N2O4S — CID 130401803
3-[[(1S)-3-[3-[(benzylamino)oxymethyl]pentan-2-yl]-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130401803) has the molecular formula C34H36ClF3N2O4S and a molecular weight of 661.19 g/mol. Its IUPAC name is 3-[[(1S)-3-[3-[(benzylamino)oxymethyl]pentan-2-yl]-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[[(1S)-3-[3-[(benzylamino)oxymethyl]pentan-2-yl]-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130401803 |
| Molecular Formula | C34H36ClF3N2O4S |
| Molecular Weight | 661.19 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | 3-[[(1S)-3-[3-[(benzylamino)oxymethyl]pentan-2-yl]-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CCC(CONCc1ccccc1)C(C)C1=C[C@@H]2CCC(C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C34H36ClF3N2O4S/c1-3-22(19-44-39-18-21-7-5-4-6-8-21)20(2)26-13-23-9-10-24(14-26)33(23)45(42,43)31-15-25(11-12-28(31)35)34(41)40-27-16-29(36)32(38)30(37)17-27/h4-8,11-13,15-17,20,22-24,33,39H,3,9-10,14,18-19H2,1-2H3,(H,40,41)/t20?,22?,23-,24?,33?/m0/s1 |
| InChIKey | WZTYHODORNWMPL-CDDPXUCKSA-N |
| XLogP | 7.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.19 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|