C32H27ClF3N3O4S — CID 140808401
3-[[(1S)-3-(2-benzyl-4-isocyano-1,2-oxazolidin-3-yl)-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 140808401) has the molecular formula C32H27ClF3N3O4S and a molecular weight of 642.10 g/mol. Its IUPAC name is 3-[[(1S)-3-(2-benzyl-4-isocyano-1,2-oxazolidin-3-yl)-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[[(1S)-3-(2-benzyl-4-isocyano-1,2-oxazolidin-3-yl)-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 140808401 |
| Molecular Formula | C32H27ClF3N3O4S |
| Molecular Weight | 642.10 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | 3-[[(1S)-3-(2-benzyl-4-isocyano-1,2-oxazolidin-3-yl)-8-bicyclo[3.2.1]oct-2-enyl]sulfonyl]-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | [C-]#[N+]C1CON(Cc2ccccc2)C1C1=C[C@@H]2CCC(C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C32H27ClF3N3O4S/c1-37-27-17-43-39(16-18-5-3-2-4-6-18)30(27)22-11-19-7-8-20(12-22)31(19)44(41,42)28-13-21(9-10-24(28)33)32(40)38-23-14-25(34)29(36)26(35)15-23/h2-6,9-11,13-15,19-20,27,30-31H,7-8,12,16-17H2,(H,38,40)/t19-,20?,27?,30?,31?/m0/s1 |
| InChIKey | ZQBRJKAPIYFSAT-QVFGHPQFSA-N |
| XLogP | 6.61 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.10 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|