C33H30ClF3N2O7S — CID 130397562
[2-benzyl-3-[(5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]-3H-1,2-oxazol-4-yl]methyl formate (PubChem CID 130397562) has the molecular formula C33H30ClF3N2O7S and a molecular weight of 691.12 g/mol. Its IUPAC name is [2-benzyl-3-[(5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]-3H-1,2-oxazol-4-yl]methyl formate.
| Compound Name | [2-benzyl-3-[(5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]-3H-1,2-oxazol-4-yl]methyl formate |
|---|---|
| PubChem CID | 130397562 |
| Molecular Formula | C33H30ClF3N2O7S |
| Molecular Weight | 691.12 g/mol |
| Exact Mass | 690.14 |
| IUPAC Name | [2-benzyl-3-[(5S)-8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]-3H-1,2-oxazol-4-yl]methyl formate |
| SMILES | O=COCC1=CON(Cc2ccccc2)C1C1(O)CC2CC[C@@H](C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C33H30ClF3N2O7S/c34-25-9-8-20(32(41)38-24-11-26(35)29(37)27(36)12-24)10-28(25)47(43,44)30-21-6-7-22(30)14-33(42,13-21)31-23(16-45-18-40)17-46-39(31)15-19-4-2-1-3-5-19/h1-5,8-12,17-18,21-22,30-31,42H,6-7,13-16H2,(H,38,41)/t21-,22?,30?,31?,33?/m0/s1 |
| InChIKey | MOPNOLPWTLRHGL-PGWMRYMASA-N |
| XLogP | 5.58 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.12 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|