C33H32ClF3N2O7S — CID 130402313
methyl (E)-3-(benzylamino)oxy-2-[[8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl]prop-2-enoate (PubChem CID 130402313) has the molecular formula C33H32ClF3N2O7S and a molecular weight of 693.14 g/mol. Its IUPAC name is methyl (E)-3-(benzylamino)oxy-2-[[8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl]prop-2-enoate.
| Compound Name | methyl (E)-3-(benzylamino)oxy-2-[[8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 130402313 |
| Molecular Formula | C33H32ClF3N2O7S |
| Molecular Weight | 693.14 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | methyl (E)-3-(benzylamino)oxy-2-[[8-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-3-hydroxy-3-bicyclo[3.2.1]octanyl]methyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/ONCc1ccccc1)CC1(O)CC2CCC(C1)C2S(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C33H32ClF3N2O7S/c1-45-32(41)23(18-46-38-17-19-5-3-2-4-6-19)16-33(42)14-21-7-8-22(15-33)30(21)47(43,44)28-11-20(9-10-25(28)34)31(40)39-24-12-26(35)29(37)27(36)13-24/h2-6,9-13,18,21-22,30,38,42H,7-8,14-17H2,1H3,(H,39,40)/b23-18+ |
| InChIKey | DBCQPJKDXASVQM-PTGBLXJZSA-N |
| XLogP | 5.87 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.14 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|