C25H27ClF3NO6S — CID 174096115
methyl 2-[(1S,2R,4S,6S)-4-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-ethyl-1-hydroxy-6-methylcyclohexyl]acetate (PubChem CID 174096115) has the molecular formula C25H27ClF3NO6S and a molecular weight of 562.01 g/mol. Its IUPAC name is methyl 2-[(1S,2R,4S,6S)-4-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-ethyl-1-hydroxy-6-methylcyclohexyl]acetate.
| Compound Name | methyl 2-[(1S,2R,4S,6S)-4-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-ethyl-1-hydroxy-6-methylcyclohexyl]acetate |
|---|---|
| PubChem CID | 174096115 |
| Molecular Formula | C25H27ClF3NO6S |
| Molecular Weight | 562.01 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | methyl 2-[(1S,2R,4S,6S)-4-[2-chloro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonyl-2-ethyl-1-hydroxy-6-methylcyclohexyl]acetate |
| SMILES | CC[C@@H]1C[C@@H](S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)C[C@H](C)[C@@]1(O)CC(=O)OC |
| InChI | InChI=1S/C25H27ClF3NO6S/c1-4-15-9-17(7-13(2)25(15,33)12-22(31)36-3)37(34,35)21-8-14(5-6-18(21)26)24(32)30-16-10-19(27)23(29)20(28)11-16/h5-6,8,10-11,13,15,17,33H,4,7,9,12H2,1-3H3,(H,30,32)/t13-,15+,17-,25-/m0/s1 |
| InChIKey | YUTRCKANRWDTOQ-YXTOVHMVSA-N |
| XLogP | 4.90 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.01 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|