C30H25ClF6N2O5S — CID 137409780
4-chloro-3-[[(5R)-3-hydroxy-3-[(E)-[4-(trifluoromethyl)phenyl]methoxyiminomethyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 137409780) has the molecular formula C30H25ClF6N2O5S and a molecular weight of 675.05 g/mol. Its IUPAC name is 4-chloro-3-[[(5R)-3-hydroxy-3-[(E)-[4-(trifluoromethyl)phenyl]methoxyiminomethyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5R)-3-hydroxy-3-[(E)-[4-(trifluoromethyl)phenyl]methoxyiminomethyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 137409780 |
| Molecular Formula | C30H25ClF6N2O5S |
| Molecular Weight | 675.05 g/mol |
| Exact Mass | 674.11 |
| IUPAC Name | 4-chloro-3-[[(5R)-3-hydroxy-3-[(E)-[4-(trifluoromethyl)phenyl]methoxyiminomethyl]-8-bicyclo[3.2.1]octanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)C2C3CC[C@@H]2CC(O)(/C=N/OCc2ccc(C(F)(F)F)cc2)C3)c1 |
| InChI | InChI=1S/C30H25ClF6N2O5S/c31-22-8-5-17(28(40)39-21-10-23(32)26(34)24(33)11-21)9-25(22)45(42,43)27-18-3-4-19(27)13-29(41,12-18)15-38-44-14-16-1-6-20(7-2-16)30(35,36)37/h1-2,5-11,15,18-19,27,41H,3-4,12-14H2,(H,39,40)/b38-15+/t18-,19?,27?,29?/m1/s1 |
| InChIKey | GGPNYTGBVSSYPE-BMEXWEDPSA-N |
| XLogP | 6.92 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.05 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|