C29H22ClF3N2O5S — CID 130425001
4-chloro-3-[[(2R,7R)-2-hydroxy-2-(5-phenyl-1,2-oxazol-3-yl)-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130425001) has the molecular formula C29H22ClF3N2O5S and a molecular weight of 603.02 g/mol. Its IUPAC name is 4-chloro-3-[[(2R,7R)-2-hydroxy-2-(5-phenyl-1,2-oxazol-3-yl)-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(2R,7R)-2-hydroxy-2-(5-phenyl-1,2-oxazol-3-yl)-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130425001 |
| Molecular Formula | C29H22ClF3N2O5S |
| Molecular Weight | 603.02 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | 4-chloro-3-[[(2R,7R)-2-hydroxy-2-(5-phenyl-1,2-oxazol-3-yl)-7-bicyclo[2.2.1]heptanyl]sulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S(=O)(=O)[C@@H]2C3CCC2[C@@](O)(c2cc(-c4ccccc4)on2)C3)c1 |
| InChI | InChI=1S/C29H22ClF3N2O5S/c30-20-9-7-16(28(36)34-18-11-21(31)26(33)22(32)12-18)10-24(20)41(38,39)27-17-6-8-19(27)29(37,14-17)25-13-23(40-35-25)15-4-2-1-3-5-15/h1-5,7,9-13,17,19,27,37H,6,8,14H2,(H,34,36)/t17?,19?,27-,29-/m1/s1 |
| InChIKey | XZFPBIQZKBUBJC-SPGZTRGUSA-N |
| XLogP | 6.12 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.02 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|