C23H25F4N3O5S — CID 146301249
tert-butyl 4-[[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 146301249) has the molecular formula C23H25F4N3O5S and a molecular weight of 531.53 g/mol. Its IUPAC name is tert-butyl 4-[[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146301249 |
| Molecular Formula | C23H25F4N3O5S |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | tert-butyl 4-[[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NS(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2F)CC1 |
| InChI | InChI=1S/C23H25F4N3O5S/c1-23(2,3)35-22(32)30-8-6-14(7-9-30)29-36(33,34)19-10-13(4-5-16(19)24)21(31)28-15-11-17(25)20(27)18(26)12-15/h4-5,10-12,14,29H,6-9H2,1-3H3,(H,28,31) |
| InChIKey | DSTPOWHQCYBSIQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|