C22H32FN3O5S — CID 55984768
tert-butyl 4-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]piperidine-1-carboxylate (PubChem CID 55984768) has the molecular formula C22H32FN3O5S and a molecular weight of 469.58 g/mol. Its IUPAC name is tert-butyl 4-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55984768 |
| Molecular Formula | C22H32FN3O5S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | tert-butyl 4-[(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C22H32FN3O5S/c1-22(2,3)31-21(28)25-13-9-17(10-14-25)24-20(27)16-7-8-18(23)19(15-16)32(29,30)26-11-5-4-6-12-26/h7-8,15,17H,4-6,9-14H2,1-3H3,(H,24,27) |
| InChIKey | ZHYYTIQLHYVFDS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |