C21H30FN3O3S — CID 56568816
4-fluoro-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 56568816) has the molecular formula C21H30FN3O3S and a molecular weight of 423.55 g/mol. Its IUPAC name is 4-fluoro-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 56568816 |
| Molecular Formula | C21H30FN3O3S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 4-fluoro-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2ccc(F)c(S(=O)(=O)N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C21H30FN3O3S/c1-16(2)7-12-24-13-8-18(9-14-24)23-21(26)17-5-6-19(22)20(15-17)29(27,28)25-10-3-4-11-25/h5-7,15,18H,3-4,8-14H2,1-2H3,(H,23,26) |
| InChIKey | OWTFXSSMDZYAGU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|