C20H30ClN3O3S — CID 9264502
4-chloro-3-piperidin-1-ylsulfonyl-N-(1-propylpiperidin-4-yl)benzamide (PubChem CID 9264502) has the molecular formula C20H30ClN3O3S and a molecular weight of 428.00 g/mol. Its IUPAC name is 4-chloro-3-piperidin-1-ylsulfonyl-N-(1-propylpiperidin-4-yl)benzamide.
| Compound Name | 4-chloro-3-piperidin-1-ylsulfonyl-N-(1-propylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 9264502 |
| Molecular Formula | C20H30ClN3O3S |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-chloro-3-piperidin-1-ylsulfonyl-N-(1-propylpiperidin-4-yl)benzamide |
| SMILES | CCCN1CCC(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C20H30ClN3O3S/c1-2-10-23-13-8-17(9-14-23)22-20(25)16-6-7-18(21)19(15-16)28(26,27)24-11-4-3-5-12-24/h6-7,15,17H,2-5,8-14H2,1H3,(H,22,25) |
| InChIKey | YSKZOCPSQJOOEQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |