C20H28ClN3O4S — CID 97076654
3-(azepan-1-ylsulfonyl)-N-[(1R,3R)-3-carbamoylcyclohexyl]-4-chlorobenzamide (PubChem CID 97076654) has the molecular formula C20H28ClN3O4S and a molecular weight of 441.98 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-[(1R,3R)-3-carbamoylcyclohexyl]-4-chlorobenzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-[(1R,3R)-3-carbamoylcyclohexyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 97076654 |
| Molecular Formula | C20H28ClN3O4S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-[(1R,3R)-3-carbamoylcyclohexyl]-4-chlorobenzamide |
| SMILES | NC(=O)[C@@H]1CCC[C@@H](NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCCC3)c2)C1 |
| InChI | InChI=1S/C20H28ClN3O4S/c21-17-9-8-15(20(26)23-16-7-5-6-14(12-16)19(22)25)13-18(17)29(27,28)24-10-3-1-2-4-11-24/h8-9,13-14,16H,1-7,10-12H2,(H2,22,25)(H,23,26)/t14-,16-/m1/s1 |
| InChIKey | JUYIEPNBQSSMCH-GDBMZVCRSA-N |
| XLogP | 2.68 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |