C25H40N4O3S — CID 55463254
4-piperidin-1-yl-3-piperidin-1-ylsulfonyl-N-(1-propylpiperidin-4-yl)benzamide (PubChem CID 55463254) has the molecular formula C25H40N4O3S and a molecular weight of 476.69 g/mol. Its IUPAC name is 4-piperidin-1-yl-3-piperidin-1-ylsulfonyl-N-(1-propylpiperidin-4-yl)benzamide.
| Compound Name | 4-piperidin-1-yl-3-piperidin-1-ylsulfonyl-N-(1-propylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 55463254 |
| Molecular Formula | C25H40N4O3S |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 4-piperidin-1-yl-3-piperidin-1-ylsulfonyl-N-(1-propylpiperidin-4-yl)benzamide |
| SMILES | CCCN1CCC(NC(=O)c2ccc(N3CCCCC3)c(S(=O)(=O)N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C25H40N4O3S/c1-2-13-27-18-11-22(12-19-27)26-25(30)21-9-10-23(28-14-5-3-6-15-28)24(20-21)33(31,32)29-16-7-4-8-17-29/h9-10,20,22H,2-8,11-19H2,1H3,(H,26,30) |
| InChIKey | RCQSQNQJMUSPBV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |