C25H37N3O5S — CID 46649142
[1-(cyclopentylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 46649142) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 46649142 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | [1-(cyclopentylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C25H37N3O5S/c1-19(24(29)26-21-10-4-5-11-21)33-25(30)20-12-13-22(27-14-6-2-7-15-27)23(18-20)34(31,32)28-16-8-3-9-17-28/h12-13,18-19,21H,2-11,14-17H2,1H3,(H,26,29) |
| InChIKey | LIDZNRQXMQYGIX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |