C24H37N3O5S — CID 42923595
[1-(tert-butylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 42923595) has the molecular formula C24H37N3O5S and a molecular weight of 479.64 g/mol. Its IUPAC name is [1-(tert-butylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 42923595 |
| Molecular Formula | C24H37N3O5S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C24H37N3O5S/c1-18(22(28)25-24(2,3)4)32-23(29)19-11-12-20(26-13-7-5-8-14-26)21(17-19)33(30,31)27-15-9-6-10-16-27/h11-12,17-18H,5-10,13-16H2,1-4H3,(H,25,28) |
| InChIKey | HIHFZZGRAQHAQA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |