C16H21NO7S — CID 26009077
[(2R)-1-methoxy-1-oxopropan-2-yl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 26009077) has the molecular formula C16H21NO7S and a molecular weight of 371.41 g/mol. Its IUPAC name is [(2R)-1-methoxy-1-oxopropan-2-yl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [(2R)-1-methoxy-1-oxopropan-2-yl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 26009077 |
| Molecular Formula | C16H21NO7S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | [(2R)-1-methoxy-1-oxopropan-2-yl] 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COC(=O)[C@@H](C)OC(=O)c1ccc(OC)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H21NO7S/c1-11(15(18)23-3)24-16(19)12-6-7-13(22-2)14(10-12)25(20,21)17-8-4-5-9-17/h6-7,10-11H,4-5,8-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | RMZJJMVEGHPDBT-LLVKDONJSA-N |
| XLogP | 1.20 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |