C13H18N2O5S — CID 27745107
N,4-dimethoxy-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 27745107) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is N,4-dimethoxy-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N,4-dimethoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 27745107 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N,4-dimethoxy-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CONC(=O)c1ccc(OC)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C13H18N2O5S/c1-19-11-6-5-10(13(16)14-20-2)9-12(11)21(17,18)15-7-3-4-8-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,14,16) |
| InChIKey | KBQAJXVWJABINU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|