C24H37N3O3S — CID 56568108
4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide (PubChem CID 56568108) has the molecular formula C24H37N3O3S and a molecular weight of 447.65 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 56568108 |
| Molecular Formula | C24H37N3O3S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2ccc(S(=O)(=O)N3CC(C)CC(C)C3)cc2)CC1 |
| InChI | InChI=1S/C24H37N3O3S/c1-18(2)9-12-26-13-10-22(11-14-26)25-24(28)21-5-7-23(8-6-21)31(29,30)27-16-19(3)15-20(4)17-27/h5-9,19-20,22H,10-17H2,1-4H3,(H,25,28) |
| InChIKey | FZRPARMNFNZDMH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|