C15H19FN2O7S — CID 142219152
4-fluoro-3-[4-(2-hydroxypropan-2-yloxycarbonyl)piperazin-1-yl]sulfonylbenzoic acid (PubChem CID 142219152) has the molecular formula C15H19FN2O7S and a molecular weight of 390.39 g/mol. Its IUPAC name is 4-fluoro-3-[4-(2-hydroxypropan-2-yloxycarbonyl)piperazin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-fluoro-3-[4-(2-hydroxypropan-2-yloxycarbonyl)piperazin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 142219152 |
| Molecular Formula | C15H19FN2O7S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-fluoro-3-[4-(2-hydroxypropan-2-yloxycarbonyl)piperazin-1-yl]sulfonylbenzoic acid |
| SMILES | CC(C)(O)OC(=O)N1CCN(S(=O)(=O)c2cc(C(=O)O)ccc2F)CC1 |
| InChI | InChI=1S/C15H19FN2O7S/c1-15(2,22)25-14(21)17-5-7-18(8-6-17)26(23,24)12-9-10(13(19)20)3-4-11(12)16/h3-4,9,22H,5-8H2,1-2H3,(H,19,20) |
| InChIKey | JRLOBYKIPCSPNA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|