C24H29F3N4O5S — CID 146301240
tert-butyl 4-[1,1-dihydroxy-7-[(3,4,5-trifluorophenyl)carbamoyl]-3,4-dihydro-2H-1λ4,2,4-benzothiadiazin-3-yl]piperidine-1-carboxylate (PubChem CID 146301240) has the molecular formula C24H29F3N4O5S and a molecular weight of 542.58 g/mol. Its IUPAC name is tert-butyl 4-[1,1-dihydroxy-7-[(3,4,5-trifluorophenyl)carbamoyl]-3,4-dihydro-2H-1λ4,2,4-benzothiadiazin-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1,1-dihydroxy-7-[(3,4,5-trifluorophenyl)carbamoyl]-3,4-dihydro-2H-1λ4,2,4-benzothiadiazin-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146301240 |
| Molecular Formula | C24H29F3N4O5S |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | tert-butyl 4-[1,1-dihydroxy-7-[(3,4,5-trifluorophenyl)carbamoyl]-3,4-dihydro-2H-1λ4,2,4-benzothiadiazin-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2Nc3ccc(C(=O)Nc4cc(F)c(F)c(F)c4)cc3S(O)(O)N2)CC1 |
| InChI | InChI=1S/C24H29F3N4O5S/c1-24(2,3)36-23(33)31-8-6-13(7-9-31)21-29-18-5-4-14(10-19(18)37(34,35)30-21)22(32)28-15-11-16(25)20(27)17(26)12-15/h4-5,10-13,21,29-30,34-35H,6-9H2,1-3H3,(H,28,32) |
| InChIKey | BCTORQLGBFHHPY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|