C19H25FN2O5 — CID 146484876
tert-butyl 4-[(3-fluoro-5-methoxycarbonylphenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 146484876) has the molecular formula C19H25FN2O5 and a molecular weight of 380.42 g/mol. Its IUPAC name is tert-butyl 4-[(3-fluoro-5-methoxycarbonylphenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-fluoro-5-methoxycarbonylphenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146484876 |
| Molecular Formula | C19H25FN2O5 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | tert-butyl 4-[(3-fluoro-5-methoxycarbonylphenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | COC(=O)c1cc(F)cc(NC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H25FN2O5/c1-19(2,3)27-18(25)22-7-5-12(6-8-22)16(23)21-15-10-13(17(24)26-4)9-14(20)11-15/h9-12H,5-8H2,1-4H3,(H,21,23) |
| InChIKey | FLUUWJMJVUDXLF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |