C21H25F3N2O7 — CID 46563536
diethyl 5-[[1-(2,2,2-trifluoroethoxycarbonyl)piperidine-4-carbonyl]amino]benzene-1,3-dicarboxylate (PubChem CID 46563536) has the molecular formula C21H25F3N2O7 and a molecular weight of 474.43 g/mol. Its IUPAC name is diethyl 5-[[1-(2,2,2-trifluoroethoxycarbonyl)piperidine-4-carbonyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[1-(2,2,2-trifluoroethoxycarbonyl)piperidine-4-carbonyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46563536 |
| Molecular Formula | C21H25F3N2O7 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | diethyl 5-[[1-(2,2,2-trifluoroethoxycarbonyl)piperidine-4-carbonyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)C2CCN(C(=O)OCC(F)(F)F)CC2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C21H25F3N2O7/c1-3-31-18(28)14-9-15(19(29)32-4-2)11-16(10-14)25-17(27)13-5-7-26(8-6-13)20(30)33-12-21(22,23)24/h9-11,13H,3-8,12H2,1-2H3,(H,25,27) |
| InChIKey | RFLABHRGAJVJTR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|