C16H19F3N2O4 — CID 26289068
ethyl 4-[[4-(trifluoromethoxy)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 26289068) has the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is ethyl 4-[[4-(trifluoromethoxy)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-(trifluoromethoxy)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 26289068 |
| Molecular Formula | C16H19F3N2O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | ethyl 4-[[4-(trifluoromethoxy)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H19F3N2O4/c1-2-24-15(23)21-9-7-11(8-10-21)14(22)20-12-3-5-13(6-4-12)25-16(17,18)19/h3-6,11H,2,7-10H2,1H3,(H,20,22) |
| InChIKey | TZKZPKGVJMMJPW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |