C24H35F3N2O9S — CID 87554936
ethyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethyl 4-[4-(trifluoromethoxy)phenoxy]piperidine-1-carboxylate (PubChem CID 87554936) has the molecular formula C24H35F3N2O9S and a molecular weight of 584.61 g/mol. Its IUPAC name is ethyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethyl 4-[4-(trifluoromethoxy)phenoxy]piperidine-1-carboxylate.
| Compound Name | ethyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethyl 4-[4-(trifluoromethoxy)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87554936 |
| Molecular Formula | C24H35F3N2O9S |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | ethyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethyl 4-[4-(trifluoromethoxy)phenoxy]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(OS(C)(=O)=O)CC1.CCOC(=O)N1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H18F3NO4.C9H17NO5S/c1-2-21-14(20)19-9-7-12(8-10-19)22-11-3-5-13(6-4-11)23-15(16,17)18;1-3-14-9(11)10-6-4-8(5-7-10)15-16(2,12)13/h3-6,12H,2,7-10H2,1H3;8H,3-7H2,1-2H3 |
| InChIKey | QPWAAJSEXVELAV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|