C15H21NO5S — CID 59142667
benzyl (4R)-4-methylsulfonyloxyazepane-1-carboxylate (PubChem CID 59142667) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is benzyl (4R)-4-methylsulfonyloxyazepane-1-carboxylate.
| Compound Name | benzyl (4R)-4-methylsulfonyloxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 59142667 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | benzyl (4R)-4-methylsulfonyloxyazepane-1-carboxylate |
| SMILES | CS(=O)(=O)O[C@@H]1CCCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H21NO5S/c1-22(18,19)21-14-8-5-10-16(11-9-14)15(17)20-12-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3/t14-/m1/s1 |
| InChIKey | KBOWPUQOGBQHLN-CQSZACIVSA-N |
| XLogP | 2.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|