C15H23NO6S — CID 86749923
benzyl 4-(hydroxymethyl)piperidine-1-carboxylate;methanesulfonic acid (PubChem CID 86749923) has the molecular formula C15H23NO6S and a molecular weight of 345.42 g/mol. Its IUPAC name is benzyl 4-(hydroxymethyl)piperidine-1-carboxylate;methanesulfonic acid.
| Compound Name | benzyl 4-(hydroxymethyl)piperidine-1-carboxylate;methanesulfonic acid |
|---|---|
| PubChem CID | 86749923 |
| Molecular Formula | C15H23NO6S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | benzyl 4-(hydroxymethyl)piperidine-1-carboxylate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(OCc1ccccc1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C14H19NO3.CH4O3S/c16-10-12-6-8-15(9-7-12)14(17)18-11-13-4-2-1-3-5-13;1-5(2,3)4/h1-5,12,16H,6-11H2;1H3,(H,2,3,4) |
| InChIKey | ACIMRNLBIWJHTA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|