C19H27NO6S — CID 164946185
2-methyl-2-[2-(1-phenylmethoxycarbonylpiperidin-4-yl)ethylsulfonyl]propanoic acid (PubChem CID 164946185) has the molecular formula C19H27NO6S and a molecular weight of 397.49 g/mol. Its IUPAC name is 2-methyl-2-[2-(1-phenylmethoxycarbonylpiperidin-4-yl)ethylsulfonyl]propanoic acid.
| Compound Name | 2-methyl-2-[2-(1-phenylmethoxycarbonylpiperidin-4-yl)ethylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 164946185 |
| Molecular Formula | C19H27NO6S |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-methyl-2-[2-(1-phenylmethoxycarbonylpiperidin-4-yl)ethylsulfonyl]propanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)(=O)CCC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H27NO6S/c1-19(2,17(21)22)27(24,25)13-10-15-8-11-20(12-9-15)18(23)26-14-16-6-4-3-5-7-16/h3-7,15H,8-14H2,1-2H3,(H,21,22) |
| InChIKey | DGHKMAVIEULZIX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |