C31H42N2O9S3 — CID 159519892
benzyl 4-acetylsulfanylpiperidine-1-carboxylate;benzyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethanethioic S-acid (PubChem CID 159519892) has the molecular formula C31H42N2O9S3 and a molecular weight of 682.88 g/mol. Its IUPAC name is benzyl 4-acetylsulfanylpiperidine-1-carboxylate;benzyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethanethioic S-acid.
| Compound Name | benzyl 4-acetylsulfanylpiperidine-1-carboxylate;benzyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethanethioic S-acid |
|---|---|
| PubChem CID | 159519892 |
| Molecular Formula | C31H42N2O9S3 |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | benzyl 4-acetylsulfanylpiperidine-1-carboxylate;benzyl 4-methylsulfonyloxypiperidine-1-carboxylate;ethanethioic S-acid |
| SMILES | CC(=O)S.CC(=O)SC1CCN(C(=O)OCc2ccccc2)CC1.CS(=O)(=O)OC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H19NO3S.C14H19NO5S.C2H4OS/c1-12(17)20-14-7-9-16(10-8-14)15(18)19-11-13-5-3-2-4-6-13;1-21(17,18)20-13-7-9-15(10-8-13)14(16)19-11-12-5-3-2-4-6-12;1-2(3)4/h2-6,14H,7-11H2,1H3;2-6,13H,7-11H2,1H3;1H3,(H,3,4) |
| InChIKey | MBRCHFXGGTUMAY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|