C21H31NO6S — CID 166078074
benzyl 4-(3-tert-butylsulfonyloxycyclobutyl)oxypiperidine-1-carboxylate (PubChem CID 166078074) has the molecular formula C21H31NO6S and a molecular weight of 425.55 g/mol. Its IUPAC name is benzyl 4-(3-tert-butylsulfonyloxycyclobutyl)oxypiperidine-1-carboxylate.
| Compound Name | benzyl 4-(3-tert-butylsulfonyloxycyclobutyl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 166078074 |
| Molecular Formula | C21H31NO6S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | benzyl 4-(3-tert-butylsulfonyloxycyclobutyl)oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)S(=O)(=O)OC1CC(OC2CCN(C(=O)OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H31NO6S/c1-21(2,3)29(24,25)28-19-13-18(14-19)27-17-9-11-22(12-10-17)20(23)26-15-16-7-5-4-6-8-16/h4-8,17-19H,9-15H2,1-3H3 |
| InChIKey | ZXQOXIBSEBXBLQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|