C17H23NO5S — CID 86748633
benzyl 2-methylsulfonyloxy-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 86748633) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is benzyl 2-methylsulfonyloxy-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | benzyl 2-methylsulfonyloxy-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 86748633 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | benzyl 2-methylsulfonyloxy-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | CS(=O)(=O)OC1CC2(CCN(C(=O)OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C17H23NO5S/c1-24(20,21)23-15-11-17(12-15)7-9-18(10-8-17)16(19)22-13-14-5-3-2-4-6-14/h2-6,15H,7-13H2,1H3 |
| InChIKey | SCJMXQSGXPFBKO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|