C18H25NO3 — CID 142324856
benzyl 2-(2-hydroxyethyl)-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 142324856) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is benzyl 2-(2-hydroxyethyl)-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | benzyl 2-(2-hydroxyethyl)-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 142324856 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | benzyl 2-(2-hydroxyethyl)-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2(CC1)CC(CCO)C2 |
| InChI | InChI=1S/C18H25NO3/c20-11-6-16-12-18(13-16)7-9-19(10-8-18)17(21)22-14-15-4-2-1-3-5-15/h1-5,16,20H,6-14H2 |
| InChIKey | PIIRYCDNZXLZLJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |