C16H19F3N4O3 — CID 162609210
N-[(Z)-2-(methylideneamino)ethenyl]-4-[4-(trifluoromethoxy)phenoxy]piperidine-1-carbohydrazide (PubChem CID 162609210) has the molecular formula C16H19F3N4O3 and a molecular weight of 372.35 g/mol. Its IUPAC name is N-[(Z)-2-(methylideneamino)ethenyl]-4-[4-(trifluoromethoxy)phenoxy]piperidine-1-carbohydrazide.
| Compound Name | N-[(Z)-2-(methylideneamino)ethenyl]-4-[4-(trifluoromethoxy)phenoxy]piperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 162609210 |
| Molecular Formula | C16H19F3N4O3 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[(Z)-2-(methylideneamino)ethenyl]-4-[4-(trifluoromethoxy)phenoxy]piperidine-1-carbohydrazide |
| SMILES | C=N/C=C\N(N)C(=O)N1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H19F3N4O3/c1-21-8-11-23(20)15(24)22-9-6-13(7-10-22)25-12-2-4-14(5-3-12)26-16(17,18)19/h2-5,8,11,13H,1,6-7,9-10,20H2/b11-8- |
| InChIKey | HPKYZLQLAXTPRN-FLIBITNWSA-N |
| XLogP | 2.90 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|