C18H23F3N2O2 — CID 175967617
N-(cyclobutylmethyl)-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide (PubChem CID 175967617) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide.
| Compound Name | N-(cyclobutylmethyl)-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 175967617 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-(cyclobutylmethyl)-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(N1CCCCC1)N(CC1CCC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H23F3N2O2/c19-18(20,21)25-16-9-7-15(8-10-16)23(13-14-5-4-6-14)17(24)22-11-2-1-3-12-22/h7-10,14H,1-6,11-13H2 |
| InChIKey | DVYHNRKCZVMXDG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |