C15H19F3N2O4S — CID 27658627
N-(3-oxo-3-piperidin-1-ylpropyl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 27658627) has the molecular formula C15H19F3N2O4S and a molecular weight of 380.39 g/mol. Its IUPAC name is N-(3-oxo-3-piperidin-1-ylpropyl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-oxo-3-piperidin-1-ylpropyl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 27658627 |
| Molecular Formula | C15H19F3N2O4S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-(3-oxo-3-piperidin-1-ylpropyl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(OC(F)(F)F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C15H19F3N2O4S/c16-15(17,18)24-12-4-6-13(7-5-12)25(22,23)19-9-8-14(21)20-10-2-1-3-11-20/h4-7,19H,1-3,8-11H2 |
| InChIKey | KVMCPERIFSUUMQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |