C21H30F3N3O5S — CID 55838634
N-pentyl-1-[3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoyl]piperidine-4-carboxamide (PubChem CID 55838634) has the molecular formula C21H30F3N3O5S and a molecular weight of 493.55 g/mol. Its IUPAC name is N-pentyl-1-[3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoyl]piperidine-4-carboxamide.
| Compound Name | N-pentyl-1-[3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55838634 |
| Molecular Formula | C21H30F3N3O5S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-pentyl-1-[3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoyl]piperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)CCNS(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H30F3N3O5S/c1-2-3-4-12-25-20(29)16-10-14-27(15-11-16)19(28)9-13-26-33(30,31)18-7-5-17(6-8-18)32-21(22,23)24/h5-8,16,26H,2-4,9-15H2,1H3,(H,25,29) |
| InChIKey | KZYCFZFYWUGTLI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|