C13H17F3N2O4S — CID 27648395
N-propan-2-yl-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide (PubChem CID 27648395) has the molecular formula C13H17F3N2O4S and a molecular weight of 354.35 g/mol. Its IUPAC name is N-propan-2-yl-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide.
| Compound Name | N-propan-2-yl-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 27648395 |
| Molecular Formula | C13H17F3N2O4S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-propan-2-yl-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide |
| SMILES | CC(C)NC(=O)CCNS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O4S/c1-9(2)18-12(19)7-8-17-23(20,21)11-5-3-10(4-6-11)22-13(14,15)16/h3-6,9,17H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | GLIXFFQRTSTFAN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |