C15H22F3N3O4S — CID 119586355
N-(1-amino-4-methylpentan-2-yl)-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide (PubChem CID 119586355) has the molecular formula C15H22F3N3O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 119586355 |
| Molecular Formula | C15H22F3N3O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide |
| SMILES | CC(C)CC(CN)NC(=O)CNS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H22F3N3O4S/c1-10(2)7-11(8-19)21-14(22)9-20-26(23,24)13-5-3-12(4-6-13)25-15(16,17)18/h3-6,10-11,20H,7-9,19H2,1-2H3,(H,21,22) |
| InChIKey | OGTMFJGCJIVSRM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |