C9H8F3NO5S — CID 2473183
2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetic acid (PubChem CID 2473183) has the molecular formula C9H8F3NO5S and a molecular weight of 299.23 g/mol. Its IUPAC name is 2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 2473183 |
| Molecular Formula | C9H8F3NO5S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F3NO5S/c10-9(11,12)18-6-1-3-7(4-2-6)19(16,17)13-5-8(14)15/h1-4,13H,5H2,(H,14,15) |
| InChIKey | QMBSEHPTXYDUHE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |