C16H16N2O9S2 — CID 169487948
2-[[4-[4-(carboxymethylsulfamoyl)phenoxy]phenyl]sulfonylamino]acetic acid (PubChem CID 169487948) has the molecular formula C16H16N2O9S2 and a molecular weight of 444.44 g/mol. Its IUPAC name is 2-[[4-[4-(carboxymethylsulfamoyl)phenoxy]phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-[4-(carboxymethylsulfamoyl)phenoxy]phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 169487948 |
| Molecular Formula | C16H16N2O9S2 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2-[[4-[4-(carboxymethylsulfamoyl)phenoxy]phenyl]sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(Oc2ccc(S(=O)(=O)NCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O9S2/c19-15(20)9-17-28(23,24)13-5-1-11(2-6-13)27-12-3-7-14(8-4-12)29(25,26)18-10-16(21)22/h1-8,17-18H,9-10H2,(H,19,20)(H,21,22) |
| InChIKey | PKRYHUNFKZDNNP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 176.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |